C27H46F2O4Si — CID 154394578
methyl 7-[(1R,2R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 154394578) has the molecular formula C27H46F2O4Si and a molecular weight of 500.74 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 154394578 |
| Molecular Formula | C27H46F2O4Si |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(CCC[C@@H]1C=CC(=O)[C@@H]1CC=CCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46F2O4Si/c1-8-20-27(28,29)24(33-34(6,7)26(2,3)4)16-13-14-21-18-19-23(30)22(21)15-11-9-10-12-17-25(31)32-5/h9,11,18-19,21-22,24H,8,10,12-17,20H2,1-7H3/t21-,22-,24?/m1/s1 |
| InChIKey | CJUKRBLASIYYGL-GNLJQLLCSA-N |
| XLogP | 7.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|