C26H40O2S — CID 154396497
4-[(1S)-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxyethyl]sulfanyl-2-methylbutan-2-ol (PubChem CID 154396497) has the molecular formula C26H40O2S and a molecular weight of 416.67 g/mol. Its IUPAC name is 4-[(1S)-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxyethyl]sulfanyl-2-methylbutan-2-ol.
| Compound Name | 4-[(1S)-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxyethyl]sulfanyl-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 154396497 |
| Molecular Formula | C26H40O2S |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 4-[(1S)-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxyethyl]sulfanyl-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCS[C@H](CO)C1=CC[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40O2S/c1-24(2,28)15-16-29-23(17-27)22-11-10-20-19-9-8-18-7-5-6-13-25(18,3)21(19)12-14-26(20,22)4/h8-9,11,20-21,23,27-28H,5-7,10,12-17H2,1-4H3/t20-,21-,23+,25-,26-/m0/s1 |
| InChIKey | GWRULDOSENVCJD-AQVPQCTMSA-N |
| XLogP | 6.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|