C15H25N — CID 15439677
2,3,4,5,6-pentaethylpyridine (PubChem CID 15439677) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,3,4,5,6-pentaethylpyridine.
| Compound Name | 2,3,4,5,6-pentaethylpyridine |
|---|---|
| PubChem CID | 15439677 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,3,4,5,6-pentaethylpyridine |
| SMILES | CCc1nc(CC)c(CC)c(CC)c1CC |
| InChI | InChI=1S/C15H25N/c1-6-11-12(7-2)14(9-4)16-15(10-5)13(11)8-3/h6-10H2,1-5H3 |
| InChIKey | NAYVPMNXHYLSBP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |