C11H15BrN2O3 — CID 154398551
2-amino-3-bromo-5-[2-(dimethylamino)-1-hydroxyethyl]benzoic acid (PubChem CID 154398551) has the molecular formula C11H15BrN2O3 and a molecular weight of 303.16 g/mol. Its IUPAC name is 2-amino-3-bromo-5-[2-(dimethylamino)-1-hydroxyethyl]benzoic acid.
| Compound Name | 2-amino-3-bromo-5-[2-(dimethylamino)-1-hydroxyethyl]benzoic acid |
|---|---|
| PubChem CID | 154398551 |
| Molecular Formula | C11H15BrN2O3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-amino-3-bromo-5-[2-(dimethylamino)-1-hydroxyethyl]benzoic acid |
| SMILES | CN(C)CC(O)c1cc(Br)c(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H15BrN2O3/c1-14(2)5-9(15)6-3-7(11(16)17)10(13)8(12)4-6/h3-4,9,15H,5,13H2,1-2H3,(H,16,17) |
| InChIKey | AQYGVIMWEXNGOY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|