C23H20F3N3O5 — CID 154399646
2,2,2-trifluoro-N-methyl-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide (PubChem CID 154399646) has the molecular formula C23H20F3N3O5 and a molecular weight of 475.42 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide |
|---|---|
| PubChem CID | 154399646 |
| Molecular Formula | C23H20F3N3O5 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1C(N1Cc3ccccc3C1=O)=C(N(C)C(=O)C(F)(F)F)C(C)(C)O2 |
| InChI | InChI=1S/C23H20F3N3O5/c1-12-15(29(32)33)9-10-16-17(12)18(28-11-13-7-5-6-8-14(13)20(28)30)19(22(2,3)34-16)27(4)21(31)23(24,25)26/h5-10H,11H2,1-4H3 |
| InChIKey | HJGWAVWRVMXKHU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|