About 2,2-bis(trifluoromethyl)propane-1,3-diamine
2,2-bis(trifluoromethyl)propane-1,3-diamine (PubChem CID 154400361) has the molecular formula C5H8F6N2
and a molecular weight of 210.12 g/mol. Its IUPAC name is 2,2-bis(trifluoromethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2,2-bis(trifluoromethyl)propane-1,3-diamine |
| PubChem CID | 154400361 |
| Molecular Formula | C5H8F6N2 |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2,2-bis(trifluoromethyl)propane-1,3-diamine |
| SMILES | NCC(CN)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H8F6N2/c6-4(7,8)3(1-12,2-13)5(9,10)11/h1-2,12-13H2 |
| InChIKey | CTCLHXTUKFOAJA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-bis(trifluoromethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(trifluoromethyl)propane-1,3-diamine?
The IUPAC name of 2,2-bis(trifluoromethyl)propane-1,3-diamine (CID 154400361) is 2,2-bis(trifluoromethyl)propane-1,3-diamine.
What is the SMILES notation for 2,2-bis(trifluoromethyl)propane-1,3-diamine?
The canonical SMILES for 2,2-bis(trifluoromethyl)propane-1,3-diamine is NCC(CN)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2,2-bis(trifluoromethyl)propane-1,3-diamine?
The InChIKey is CTCLHXTUKFOAJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F6N2/c6-4(7,8)3(1-12,2-13)5(9,10)11/h1-2,12-13H2.
What are the key properties of 2,2-bis(trifluoromethyl)propane-1,3-diamine?
2,2-bis(trifluoromethyl)propane-1,3-diamine has a molecular weight of 210.12 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(trifluoromethyl)propane-1,3-diamine is sourced from PubChem (CID 154400361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).