C5H2F5N — CID 154400515
2,3,4,4,5-pentafluorocyclopent-2-en-1-imine (PubChem CID 154400515) has the molecular formula C5H2F5N and a molecular weight of 171.07 g/mol. Its IUPAC name is 2,3,4,4,5-pentafluorocyclopent-2-en-1-imine.
| Compound Name | 2,3,4,4,5-pentafluorocyclopent-2-en-1-imine |
|---|---|
| PubChem CID | 154400515 |
| Molecular Formula | C5H2F5N |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | 2,3,4,4,5-pentafluorocyclopent-2-en-1-imine |
| SMILES | [H]/N=C1\C(F)=C(F)C(F)(F)C1F |
| InChI | InChI=1S/C5H2F5N/c6-1-2(11)4(8)5(9,10)3(1)7/h4,11H/b11-2+ |
| InChIKey | FVRRVBMZJGSJIT-BIIKFXOESA-N |
| XLogP | 2.14 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|