C10H17NO3S — CID 154400842
2-[cyclopentyl(3-sulfanylpropanoyl)amino]acetic acid (PubChem CID 154400842) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-[cyclopentyl(3-sulfanylpropanoyl)amino]acetic acid.
| Compound Name | 2-[cyclopentyl(3-sulfanylpropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 154400842 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[cyclopentyl(3-sulfanylpropanoyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)CCS)C1CCCC1 |
| InChI | InChI=1S/C10H17NO3S/c12-9(5-6-15)11(7-10(13)14)8-3-1-2-4-8/h8,15H,1-7H2,(H,13,14) |
| InChIKey | WSCRVECTAANFFC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|