C38H26O8S — CID 154400990
[4-[4-benzoyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] benzoate (PubChem CID 154400990) has the molecular formula C38H26O8S and a molecular weight of 642.69 g/mol. Its IUPAC name is [4-[4-benzoyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] benzoate.
| Compound Name | [4-[4-benzoyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] benzoate |
|---|---|
| PubChem CID | 154400990 |
| Molecular Formula | C38H26O8S |
| Molecular Weight | 642.69 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | [4-[4-benzoyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)c3ccccc3)cc2-c2ccc(O)cc2)c(-c2ccc(O)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C38H26O8S/c39-29-15-11-25(12-16-29)33-23-31(45-37(41)27-7-3-1-4-8-27)19-21-35(33)47(43,44)36-22-20-32(46-38(42)28-9-5-2-6-10-28)24-34(36)26-13-17-30(40)18-14-26/h1-24,39-40H |
| InChIKey | VSBNQIIDTDRLOL-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.69 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|