C24H22O6 — CID 154401782
2-[(3aR,4R,5R,6aS)-2-oxo-4-(3-oxo-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]benzoic acid (PubChem CID 154401782) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-[(3aR,4R,5R,6aS)-2-oxo-4-(3-oxo-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]benzoic acid.
| Compound Name | 2-[(3aR,4R,5R,6aS)-2-oxo-4-(3-oxo-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]benzoic acid |
|---|---|
| PubChem CID | 154401782 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[(3aR,4R,5R,6aS)-2-oxo-4-(3-oxo-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]benzoic acid |
| SMILES | O=C(C=C[C@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1c1ccccc1C(=O)O)COc1ccccc1 |
| InChI | InChI=1S/C24H22O6/c25-15(14-29-16-6-2-1-3-7-16)10-11-18-20(12-22-21(18)13-23(26)30-22)17-8-4-5-9-19(17)24(27)28/h1-11,18,20-22H,12-14H2,(H,27,28)/t18-,20+,21-,22+/m1/s1 |
| InChIKey | UPCOHHHLUJAZKX-ZDFPQIBNSA-N |
| XLogP | 3.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|