About 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine
5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine (PubChem CID 154402255) has the molecular formula C10H11F3N4O
and a molecular weight of 260.22 g/mol. Its IUPAC name is 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine |
| PubChem CID | 154402255 |
| Molecular Formula | C10H11F3N4O |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine |
| SMILES | CCOc1nc(C(F)(F)F)ncc1N1C=NCC1 |
| InChI | InChI=1S/C10H11F3N4O/c1-2-18-8-7(17-4-3-14-6-17)5-15-9(16-8)10(11,12)13/h5-6H,2-4H2,1H3 |
| InChIKey | DYKGBSOPIYQRSK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine?
The IUPAC name of 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine (CID 154402255) is 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine?
The canonical SMILES for 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine is CCOc1nc(C(F)(F)F)ncc1N1C=NCC1.
What is the InChIKey of 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine?
The InChIKey is DYKGBSOPIYQRSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N4O/c1-2-18-8-7(17-4-3-14-6-17)5-15-9(16-8)10(11,12)13/h5-6H,2-4H2,1H3.
What are the key properties of 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine?
5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine has a molecular weight of 260.22 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dihydroimidazol-1-yl)-4-ethoxy-2-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 154402255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).