C17H23FN2O2 — CID 154402673
ethyl (2R)-1-[(3-fluorophenyl)methylideneamino]-2-propylpyrrolidine-2-carboxylate (PubChem CID 154402673) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is ethyl (2R)-1-[(3-fluorophenyl)methylideneamino]-2-propylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-[(3-fluorophenyl)methylideneamino]-2-propylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154402673 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | ethyl (2R)-1-[(3-fluorophenyl)methylideneamino]-2-propylpyrrolidine-2-carboxylate |
| SMILES | CCC[C@]1(C(=O)OCC)CCCN1N=Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H23FN2O2/c1-3-9-17(16(21)22-4-2)10-6-11-20(17)19-13-14-7-5-8-15(18)12-14/h5,7-8,12-13H,3-4,6,9-11H2,1-2H3/t17-/m1/s1 |
| InChIKey | RSNXGJPJIRWJSO-QGZVFWFLSA-N |
| XLogP | 3.36 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|