About 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol
2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol (PubChem CID 154403059) has the molecular formula C26H42O3
and a molecular weight of 402.62 g/mol. Its IUPAC name is 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol.
Molecular Properties
| Compound Name | 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol |
| PubChem CID | 154403059 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol |
| SMILES | CCC1(CC)CCC(Oc2cccc(O)c2OC2CCC(CC)(CC)CC2)CC1 |
| InChI | InChI=1S/C26H42O3/c1-5-25(6-2)16-12-20(13-17-25)28-23-11-9-10-22(27)24(23)29-21-14-18-26(7-3,8-4)19-15-21/h9-11,20-21,27H,5-8,12-19H2,1-4H3 |
| InChIKey | WELFGIFNJFLRSA-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol?
The IUPAC name of 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol (CID 154403059) is 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol.
What is the SMILES notation for 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol?
The canonical SMILES for 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol is CCC1(CC)CCC(Oc2cccc(O)c2OC2CCC(CC)(CC)CC2)CC1.
What is the InChIKey of 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol?
The InChIKey is WELFGIFNJFLRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42O3/c1-5-25(6-2)16-12-20(13-17-25)28-23-11-9-10-22(27)24(23)29-21-14-18-26(7-3,8-4)19-15-21/h9-11,20-21,27H,5-8,12-19H2,1-4H3.
What are the key properties of 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol?
2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol has a molecular weight of 402.62 g/mol, XLogP of 7.65, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[(4,4-diethylcyclohexyl)oxy]phenol is sourced from PubChem (CID 154403059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).