About 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine
5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine (PubChem CID 154404014) has the molecular formula C11H14N4S
and a molecular weight of 234.33 g/mol. Its IUPAC name is 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine |
| PubChem CID | 154404014 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1ncc(Cc2sc(C)nc2C)c(N)n1 |
| InChI | InChI=1S/C11H14N4S/c1-6-10(16-8(3)14-6)4-9-5-13-7(2)15-11(9)12/h5H,4H2,1-3H3,(H2,12,13,15) |
| InChIKey | GFRVFXRMXBTPMH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine?
The IUPAC name of 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine (CID 154404014) is 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine.
What is the SMILES notation for 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine?
The canonical SMILES for 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine is Cc1ncc(Cc2sc(C)nc2C)c(N)n1.
What is the InChIKey of 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine?
The InChIKey is GFRVFXRMXBTPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4S/c1-6-10(16-8(3)14-6)4-9-5-13-7(2)15-11(9)12/h5H,4H2,1-3H3,(H2,12,13,15).
What are the key properties of 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine?
5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine has a molecular weight of 234.33 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylpyrimidin-4-amine is sourced from PubChem (CID 154404014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).