C30H46O4Si — CID 154404400
propan-2-yl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(2-methylphenyl)ethenyl]-5-oxocyclopentyl]hept-5-enoate (PubChem CID 154404400) has the molecular formula C30H46O4Si and a molecular weight of 498.78 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(2-methylphenyl)ethenyl]-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(2-methylphenyl)ethenyl]-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 154404400 |
| Molecular Formula | C30H46O4Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(2-methylphenyl)ethenyl]-5-oxocyclopentyl]hept-5-enoate |
| SMILES | Cc1ccccc1/C=C/[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(C)C |
| InChI | InChI=1S/C30H46O4Si/c1-22(2)33-29(32)18-12-10-9-11-17-25-26(20-19-24-16-14-13-15-23(24)3)28(21-27(25)31)34-35(7,8)30(4,5)6/h9,11,13-16,19-20,22,25-26,28H,10,12,17-18,21H2,1-8H3/b11-9-,20-19+/t25-,26-,28-/m1/s1 |
| InChIKey | OURRDVKADWDKNO-PDDYKLEKSA-N |
| XLogP | 7.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|