C28H44N4O7SSi — CID 154404442
[(1R,2S,4R)-4-[[5-[4-[(1R)-1-hydroxy-2-methylprop-2-enyl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methyl sulfamate (PubChem CID 154404442) has the molecular formula C28H44N4O7SSi and a molecular weight of 608.83 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[4-[(1R)-1-hydroxy-2-methylprop-2-enyl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[4-[(1R)-1-hydroxy-2-methylprop-2-enyl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 154404442 |
| Molecular Formula | C28H44N4O7SSi |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[4-[(1R)-1-hydroxy-2-methylprop-2-enyl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methyl sulfamate |
| SMILES | C=C(C)[C@@H](O)c1coc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C2)c1 |
| InChI | InChI=1S/C28H44N4O7SSi/c1-16(2)26(33)21-10-25(37-13-21)27(34)23-12-30-15-31-28(23)32-22-9-20(14-38-40(29,35)36)24(11-22)39-41(17(3)4,18(5)6)19(7)8/h10,12-13,15,17-20,22,24,26,33H,1,9,11,14H2,2-8H3,(H2,29,35,36)(H,30,31,32)/t20-,22-,24+,26-/m1/s1 |
| InChIKey | OPINGZHFAAVKGV-XOROXPFSSA-N |
| XLogP | 4.88 |
| TPSA | 166.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|