About chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane
chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane (PubChem CID 154404543) has the molecular formula C10H17ClSi
and a molecular weight of 200.78 g/mol. Its IUPAC name is chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane.
Molecular Properties
| Compound Name | chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane |
| PubChem CID | 154404543 |
| Molecular Formula | C10H17ClSi |
| Molecular Weight | 200.78 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane |
| SMILES | C[Si](C)(Cl)CCCC1=CC=CC1 |
| InChI | InChI=1S/C10H17ClSi/c1-12(2,11)9-5-8-10-6-3-4-7-10/h3-4,6H,5,7-9H2,1-2H3 |
| InChIKey | OTROOHGNMGZNNG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane?
The IUPAC name of chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane (CID 154404543) is chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane.
What is the SMILES notation for chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane?
The canonical SMILES for chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane is C[Si](C)(Cl)CCCC1=CC=CC1.
What is the InChIKey of chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane?
The InChIKey is OTROOHGNMGZNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClSi/c1-12(2,11)9-5-8-10-6-3-4-7-10/h3-4,6H,5,7-9H2,1-2H3.
What are the key properties of chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane?
chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane has a molecular weight of 200.78 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(3-cyclopenta-1,3-dien-1-ylpropyl)-dimethylsilane is sourced from PubChem (CID 154404543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).