About chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane
chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane (PubChem CID 154404660) has the molecular formula C4H11Cl3OSi2
and a molecular weight of 237.66 g/mol. Its IUPAC name is chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane.
Molecular Properties
| Compound Name | chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane |
| PubChem CID | 154404660 |
| Molecular Formula | C4H11Cl3OSi2 |
| Molecular Weight | 237.66 g/mol |
| Exact Mass | 235.94 |
| IUPAC Name | chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane |
| SMILES | C[Si](C)(Cl)O[SiH2]CC(Cl)Cl |
| InChI | InChI=1S/C4H11Cl3OSi2/c1-10(2,7)8-9-3-4(5)6/h4H,3,9H2,1-2H3 |
| InChIKey | CXIMXHWYSUUYSO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane?
The IUPAC name of chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane (CID 154404660) is chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane.
What is the SMILES notation for chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane?
The canonical SMILES for chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane is C[Si](C)(Cl)O[SiH2]CC(Cl)Cl.
What is the InChIKey of chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane?
The InChIKey is CXIMXHWYSUUYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11Cl3OSi2/c1-10(2,7)8-9-3-4(5)6/h4H,3,9H2,1-2H3.
What are the key properties of chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane?
chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane has a molecular weight of 237.66 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(2,2-dichloroethylsilyloxy)-dimethylsilane is sourced from PubChem (CID 154404660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).