About 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate
4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 154404711) has the molecular formula C9H7F3N3O5S-
and a molecular weight of 326.23 g/mol. Its IUPAC name is 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
Molecular Properties
| Compound Name | 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| PubChem CID | 154404711 |
| Molecular Formula | C9H7F3N3O5S- |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | O=C([O-])N1CCc2c(ncnc2OS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H8F3N3O5S/c10-9(11,12)21(18,19)20-7-5-1-2-15(8(16)17)3-6(5)13-4-14-7/h4H,1-3H2,(H,16,17)/p-1 |
| InChIKey | CSYIWNOPNLDEDF-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate?
The IUPAC name of 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (CID 154404711) is 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
What is the SMILES notation for 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate?
The canonical SMILES for 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate is O=C([O-])N1CCc2c(ncnc2OS(=O)(=O)C(F)(F)F)C1.
What is the InChIKey of 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate?
The InChIKey is CSYIWNOPNLDEDF-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8F3N3O5S/c10-9(11,12)21(18,19)20-7-5-1-2-15(8(16)17)3-6(5)13-4-14-7/h4H,1-3H2,(H,16,17)/p-1.
What are the key properties of 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate?
4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate has a molecular weight of 326.23 g/mol, XLogP of -0.59, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate is sourced from PubChem (CID 154404711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).