About 10,10-diiodononadecane
10,10-diiodononadecane (PubChem CID 154405241) has the molecular formula C19H38I2
and a molecular weight of 520.32 g/mol. Its IUPAC name is 10,10-diiodononadecane.
Molecular Properties
| Compound Name | 10,10-diiodononadecane |
| PubChem CID | 154405241 |
| Molecular Formula | C19H38I2 |
| Molecular Weight | 520.32 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 10,10-diiodononadecane |
| SMILES | CCCCCCCCCC(I)(I)CCCCCCCCC |
| InChI | InChI=1S/C19H38I2/c1-3-5-7-9-11-13-15-17-19(20,21)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
| InChIKey | HRWIGAUSSHDUJP-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.32 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 10,10-diiodononadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-diiodononadecane?
The IUPAC name of 10,10-diiodononadecane (CID 154405241) is 10,10-diiodononadecane.
What is the SMILES notation for 10,10-diiodononadecane?
The canonical SMILES for 10,10-diiodononadecane is CCCCCCCCCC(I)(I)CCCCCCCCC.
What is the InChIKey of 10,10-diiodononadecane?
The InChIKey is HRWIGAUSSHDUJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38I2/c1-3-5-7-9-11-13-15-17-19(20,21)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3.
What are the key properties of 10,10-diiodononadecane?
10,10-diiodononadecane has a molecular weight of 520.32 g/mol, XLogP of 8.83, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-diiodononadecane is sourced from PubChem (CID 154405241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).