About N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide
N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide (PubChem CID 154405807) has the molecular formula C8H13NO4S
and a molecular weight of 219.26 g/mol. Its IUPAC name is N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide |
| PubChem CID | 154405807 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N=C[C@H]1CC[C@@H](C=O)O1 |
| InChI | InChI=1S/C8H13NO4S/c1-2-14(11,12)9-5-7-3-4-8(6-10)13-7/h5-8H,2-4H2,1H3/t7-,8+/m1/s1 |
| InChIKey | HSMJVLSGCCTHDI-SFYZADRCSA-N |
| XLogP | 0.15 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide?
The IUPAC name of N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide (CID 154405807) is N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide.
What is the SMILES notation for N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide?
The canonical SMILES for N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide is CCS(=O)(=O)N=C[C@H]1CC[C@@H](C=O)O1.
What is the InChIKey of N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide?
The InChIKey is HSMJVLSGCCTHDI-SFYZADRCSA-N. The full InChI is InChI=1S/C8H13NO4S/c1-2-14(11,12)9-5-7-3-4-8(6-10)13-7/h5-8H,2-4H2,1H3/t7-,8+/m1/s1.
What are the key properties of N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide?
N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide has a molecular weight of 219.26 g/mol, XLogP of 0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R,5S)-5-formyloxolan-2-yl]methylidene]ethanesulfonamide is sourced from PubChem (CID 154405807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).