C18H43NO4Si2 — CID 154406545
2-(3-ethoxysilylpropoxy)-N-[2-(3-ethoxysilylpropoxy)-2-methylpropyl]-2-methylpropan-1-amine (PubChem CID 154406545) has the molecular formula C18H43NO4Si2 and a molecular weight of 393.72 g/mol. Its IUPAC name is 2-(3-ethoxysilylpropoxy)-N-[2-(3-ethoxysilylpropoxy)-2-methylpropyl]-2-methylpropan-1-amine.
| Compound Name | 2-(3-ethoxysilylpropoxy)-N-[2-(3-ethoxysilylpropoxy)-2-methylpropyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 154406545 |
| Molecular Formula | C18H43NO4Si2 |
| Molecular Weight | 393.72 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 2-(3-ethoxysilylpropoxy)-N-[2-(3-ethoxysilylpropoxy)-2-methylpropyl]-2-methylpropan-1-amine |
| SMILES | CCO[SiH2]CCCOC(C)(C)CNCC(C)(C)OCCC[SiH2]OCC |
| InChI | InChI=1S/C18H43NO4Si2/c1-7-22-24-13-9-11-20-17(3,4)15-19-16-18(5,6)21-12-10-14-25-23-8-2/h19H,7-16,24-25H2,1-6H3 |
| InChIKey | RGQGJJUFFJKKTA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|