C20H25F3N6O5 — CID 154407284
tert-butyl 4-[3-[N'-hydroxy-N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate (PubChem CID 154407284) has the molecular formula C20H25F3N6O5 and a molecular weight of 486.45 g/mol. Its IUPAC name is tert-butyl 4-[3-[N'-hydroxy-N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[N'-hydroxy-N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154407284 |
| Molecular Formula | C20H25F3N6O5 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | tert-butyl 4-[3-[N'-hydroxy-N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(=O)[nH]c3c(C(=NO)NC(=O)CC(F)(F)F)cnn23)CC1 |
| InChI | InChI=1S/C20H25F3N6O5/c1-19(2,3)34-18(32)28-6-4-11(5-7-28)13-8-14(30)26-17-12(10-24-29(13)17)16(27-33)25-15(31)9-20(21,22)23/h8,10-11,33H,4-7,9H2,1-3H3,(H,26,30)(H,25,27,31) |
| InChIKey | ZGGVNYSKNRYSTC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|