C24H20ClF2N3O3 — CID 154408571
3-(3-chlorophenyl)-1-(3,3-difluorocyclohexyl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione (PubChem CID 154408571) has the molecular formula C24H20ClF2N3O3 and a molecular weight of 471.89 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(3,3-difluorocyclohexyl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-1-(3,3-difluorocyclohexyl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione |
|---|---|
| PubChem CID | 154408571 |
| Molecular Formula | C24H20ClF2N3O3 |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(3,3-difluorocyclohexyl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione |
| SMILES | COc1cccc2c1ncc1c(=O)n(-c3cccc(Cl)c3)c(=O)n(C3CCCC(F)(F)C3)c12 |
| InChI | InChI=1S/C24H20ClF2N3O3/c1-33-19-9-3-8-17-20(19)28-13-18-21(17)29(16-7-4-10-24(26,27)12-16)23(32)30(22(18)31)15-6-2-5-14(25)11-15/h2-3,5-6,8-9,11,13,16H,4,7,10,12H2,1H3 |
| InChIKey | AKSKEQSZGMOZKW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|