About bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium
bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium (PubChem CID 154409030) has the molecular formula C19H32Cl2HfSi2-2
and a molecular weight of 566.03 g/mol. Its IUPAC name is bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium.
Molecular Properties
| Compound Name | bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium |
| PubChem CID | 154409030 |
| Molecular Formula | C19H32Cl2HfSi2-2 |
| Molecular Weight | 566.03 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium |
| SMILES | CC(C)=[Hf](Cl)Cl.C[Si](C)(C)c1cc[cH-]c1.C[Si](C)(C)c1cc[cH-]c1 |
| InChI | InChI=1S/2C8H13Si.C3H6.2ClH.Hf/c2*1-9(2,3)8-6-4-5-7-8;1-3-2;;;/h2*4-7H,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | ICSDLIFFTDMBNE-UHFFFAOYSA-L |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.03 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium?
The IUPAC name of bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium (CID 154409030) is bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium.
What is the SMILES notation for bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium?
The canonical SMILES for bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium is CC(C)=[Hf](Cl)Cl.C[Si](C)(C)c1cc[cH-]c1.C[Si](C)(C)c1cc[cH-]c1.
What is the InChIKey of bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium?
The InChIKey is ICSDLIFFTDMBNE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H13Si.C3H6.2ClH.Hf/c2*1-9(2,3)8-6-4-5-7-8;1-3-2;;;/h2*4-7H,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2.
What are the key properties of bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium?
bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium has a molecular weight of 566.03 g/mol, XLogP of 6.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);dichloro(propan-2-ylidene)hafnium is sourced from PubChem (CID 154409030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).