C21H24O3 — CID 154409602
(8S,9S,10S,13S,14S)-13-methyl-10-prop-2-ynoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 154409602) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-13-methyl-10-prop-2-ynoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9S,10S,13S,14S)-13-methyl-10-prop-2-ynoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 154409602 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (8S,9S,10S,13S,14S)-13-methyl-10-prop-2-ynoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C#CC(=O)[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H24O3/c1-3-18(23)21-11-8-14(22)12-13(21)4-5-15-16-6-7-19(24)20(16,2)10-9-17(15)21/h1,12,15-17H,4-11H2,2H3/t15-,16-,17-,20-,21+/m0/s1 |
| InChIKey | JQVZTMPVWCBBHA-YRJWVXGYSA-N |
| XLogP | 3.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|