About 1,5-ditert-butylcyclopenta-1,3-diene;manganese
1,5-ditert-butylcyclopenta-1,3-diene;manganese (PubChem CID 154410270) has the molecular formula C13H21Mn-
and a molecular weight of 232.25 g/mol. Its IUPAC name is 1,5-ditert-butylcyclopenta-1,3-diene;manganese.
Molecular Properties
| Compound Name | 1,5-ditert-butylcyclopenta-1,3-diene;manganese |
| PubChem CID | 154410270 |
| Molecular Formula | C13H21Mn- |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1,5-ditert-butylcyclopenta-1,3-diene;manganese |
| SMILES | CC(C)(C)c1ccc[c-]1C(C)(C)C.[Mn] |
| InChI | InChI=1S/C13H21.Mn/c1-12(2,3)10-8-7-9-11(10)13(4,5)6;/h7-9H,1-6H3;/q-1; |
| InChIKey | BYJIRMBKXAPCMH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,5-ditert-butylcyclopenta-1,3-diene;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-ditert-butylcyclopenta-1,3-diene;manganese?
The IUPAC name of 1,5-ditert-butylcyclopenta-1,3-diene;manganese (CID 154410270) is 1,5-ditert-butylcyclopenta-1,3-diene;manganese.
What is the SMILES notation for 1,5-ditert-butylcyclopenta-1,3-diene;manganese?
The canonical SMILES for 1,5-ditert-butylcyclopenta-1,3-diene;manganese is CC(C)(C)c1ccc[c-]1C(C)(C)C.[Mn].
What is the InChIKey of 1,5-ditert-butylcyclopenta-1,3-diene;manganese?
The InChIKey is BYJIRMBKXAPCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21.Mn/c1-12(2,3)10-8-7-9-11(10)13(4,5)6;/h7-9H,1-6H3;/q-1;.
What are the key properties of 1,5-ditert-butylcyclopenta-1,3-diene;manganese?
1,5-ditert-butylcyclopenta-1,3-diene;manganese has a molecular weight of 232.25 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-ditert-butylcyclopenta-1,3-diene;manganese is sourced from PubChem (CID 154410270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).