About CID 154410770
CID 154410770 (PubChem CID 154410770) has the molecular formula C18H30O2S
and a molecular weight of 310.50 g/mol.
Molecular Properties
| Compound Name | CID 154410770 |
| PubChem CID | 154410770 |
| Molecular Formula | C18H30O2S |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | — |
| SMILES | CCCCC/C=C\CCSCC=C=CCCCC(=O)OC |
| InChI | InChI=1S/C18H30O2S/c1-3-4-5-6-7-10-13-16-21-17-14-11-8-9-12-15-18(19)20-2/h7-8,10,14H,3-6,9,12-13,15-17H2,1-2H3/b10-7- |
| InChIKey | ZTGPABMWZZSQLB-YFHOEESVSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 154410770 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154410770?
The IUPAC name of CID 154410770 (CID 154410770) is not available.
What is the SMILES notation for CID 154410770?
The canonical SMILES for CID 154410770 is CCCCC/C=C\CCSCC=C=CCCCC(=O)OC.
What is the InChIKey of CID 154410770?
The InChIKey is ZTGPABMWZZSQLB-YFHOEESVSA-N. The full InChI is InChI=1S/C18H30O2S/c1-3-4-5-6-7-10-13-16-21-17-14-11-8-9-12-15-18(19)20-2/h7-8,10,14H,3-6,9,12-13,15-17H2,1-2H3/b10-7-.
What are the key properties of CID 154410770?
CID 154410770 has a molecular weight of 310.50 g/mol, XLogP of 5.30, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154410770 is sourced from PubChem (CID 154410770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).