About CID 154410782
CID 154410782 (PubChem CID 154410782) has the molecular formula C17H28O2S
and a molecular weight of 296.48 g/mol.
Molecular Properties
| Compound Name | CID 154410782 |
| PubChem CID | 154410782 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | — |
| SMILES | CCCCC/C=C\CSCC=C=CCCCC(=O)OC |
| InChI | InChI=1S/C17H28O2S/c1-3-4-5-6-9-12-15-20-16-13-10-7-8-11-14-17(18)19-2/h7,9,12-13H,3-6,8,11,14-16H2,1-2H3/b12-9- |
| InChIKey | CBNBWPFUTBRMMC-XFXZXTDPSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 154410782 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154410782?
The IUPAC name of CID 154410782 (CID 154410782) is not available.
What is the SMILES notation for CID 154410782?
The canonical SMILES for CID 154410782 is CCCCC/C=C\CSCC=C=CCCCC(=O)OC.
What is the InChIKey of CID 154410782?
The InChIKey is CBNBWPFUTBRMMC-XFXZXTDPSA-N. The full InChI is InChI=1S/C17H28O2S/c1-3-4-5-6-9-12-15-20-16-13-10-7-8-11-14-17(18)19-2/h7,9,12-13H,3-6,8,11,14-16H2,1-2H3/b12-9-.
What are the key properties of CID 154410782?
CID 154410782 has a molecular weight of 296.48 g/mol, XLogP of 4.91, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154410782 is sourced from PubChem (CID 154410782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).