C8H7Cl3O4 — CID 154411642
(8Z)-3,4,4-trichloro-3,5-dihydro-2H-1,6-dioxecine-7,10-dione (PubChem CID 154411642) has the molecular formula C8H7Cl3O4 and a molecular weight of 273.50 g/mol. Its IUPAC name is (8Z)-3,4,4-trichloro-3,5-dihydro-2H-1,6-dioxecine-7,10-dione.
| Compound Name | (8Z)-3,4,4-trichloro-3,5-dihydro-2H-1,6-dioxecine-7,10-dione |
|---|---|
| PubChem CID | 154411642 |
| Molecular Formula | C8H7Cl3O4 |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | (8Z)-3,4,4-trichloro-3,5-dihydro-2H-1,6-dioxecine-7,10-dione |
| SMILES | O=C1/C=C\C(=O)OCC(Cl)(Cl)C(Cl)CO1 |
| InChI | InChI=1S/C8H7Cl3O4/c9-5-3-14-6(12)1-2-7(13)15-4-8(5,10)11/h1-2,5H,3-4H2/b2-1- |
| InChIKey | PRZKLGXPPRQRPE-UPHRSURJSA-N |
| XLogP | 1.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|