C22H32N2O — CID 154413112
6-[methoxy-(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methyl]-1-methyl-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 154413112) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 6-[methoxy-(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methyl]-1-methyl-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 6-[methoxy-(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methyl]-1-methyl-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 154413112 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 6-[methoxy-(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methyl]-1-methyl-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | COC(C1=CC=C2C(CCCN2C)C1)C1=CC=C2C(CCCN2C)C1 |
| InChI | InChI=1S/C22H32N2O/c1-23-12-4-6-16-14-18(8-10-20(16)23)22(25-3)19-9-11-21-17(15-19)7-5-13-24(21)2/h8-11,16-17,22H,4-7,12-15H2,1-3H3 |
| InChIKey | MEDIILUJRALTEF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |