About 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene
5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene (PubChem CID 154413718) has the molecular formula C10H14Cl2S
and a molecular weight of 237.19 g/mol. Its IUPAC name is 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene |
| PubChem CID | 154413718 |
| Molecular Formula | C10H14Cl2S |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene |
| SMILES | CC(C)(C)SC1(Cl)C=CC=C(Cl)C1 |
| InChI | InChI=1S/C10H14Cl2S/c1-9(2,3)13-10(12)6-4-5-8(11)7-10/h4-6H,7H2,1-3H3 |
| InChIKey | WTZWRDGIHASVPW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene?
The IUPAC name of 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene (CID 154413718) is 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene.
What is the SMILES notation for 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene?
The canonical SMILES for 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene is CC(C)(C)SC1(Cl)C=CC=C(Cl)C1.
What is the InChIKey of 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene?
The InChIKey is WTZWRDGIHASVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2S/c1-9(2,3)13-10(12)6-4-5-8(11)7-10/h4-6H,7H2,1-3H3.
What are the key properties of 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene?
5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene has a molecular weight of 237.19 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butylsulfanyl-1,5-dichlorocyclohexa-1,3-diene is sourced from PubChem (CID 154413718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).