About (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol
(2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol (PubChem CID 15441583) has the molecular formula C14H22O3S
and a molecular weight of 270.39 g/mol. Its IUPAC name is (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol.
Molecular Properties
| Compound Name | (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol |
| PubChem CID | 15441583 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol |
| SMILES | C[C@H](O)[C@H](CC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H22O3S/c1-11(15)13(10-14(2,3)4)18(16,17)12-8-6-5-7-9-12/h5-9,11,13,15H,10H2,1-4H3/t11-,13-/m0/s1 |
| InChIKey | YUEMDVUHKPLUIC-AAEUAGOBSA-N |
| XLogP | 2.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol?
The IUPAC name of (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol (CID 15441583) is (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol.
What is the SMILES notation for (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol?
The canonical SMILES for (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol is C[C@H](O)[C@H](CC(C)(C)C)S(=O)(=O)c1ccccc1.
What is the InChIKey of (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol?
The InChIKey is YUEMDVUHKPLUIC-AAEUAGOBSA-N. The full InChI is InChI=1S/C14H22O3S/c1-11(15)13(10-14(2,3)4)18(16,17)12-8-6-5-7-9-12/h5-9,11,13,15H,10H2,1-4H3/t11-,13-/m0/s1.
What are the key properties of (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol?
(2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol has a molecular weight of 270.39 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-(benzenesulfonyl)-5,5-dimethylhexan-2-ol is sourced from PubChem (CID 15441583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).