C14H13N5O5S3 — CID 154417555
(6R)-3-(azidomethyl)-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154417555) has the molecular formula C14H13N5O5S3 and a molecular weight of 427.49 g/mol. Its IUPAC name is (6R)-3-(azidomethyl)-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-(azidomethyl)-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154417555 |
| Molecular Formula | C14H13N5O5S3 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | (6R)-3-(azidomethyl)-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | [N-]=[N+]=NCC1=C(C(=O)O)N2C(=O)C(NC(=O)CS(=O)c3cccs3)[C@H]2SC1 |
| InChI | InChI=1S/C14H13N5O5S3/c15-18-16-4-7-5-26-13-10(12(21)19(13)11(7)14(22)23)17-8(20)6-27(24)9-2-1-3-25-9/h1-3,10,13H,4-6H2,(H,17,20)(H,22,23)/t10?,13-,27?/m1/s1 |
| InChIKey | JDFIITUWTJBKHP-VAGMKELTSA-N |
| XLogP | 0.90 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|