About 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole
3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole (PubChem CID 154417745) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole |
| PubChem CID | 154417745 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole |
| SMILES | COc1ccc(C2C=CNN2)cc1 |
| InChI | InChI=1S/C10H12N2O/c1-13-9-4-2-8(3-5-9)10-6-7-11-12-10/h2-7,10-12H,1H3 |
| InChIKey | KGBYMMNGCFTHHV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole?
The IUPAC name of 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole (CID 154417745) is 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole.
What is the SMILES notation for 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole?
The canonical SMILES for 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole is COc1ccc(C2C=CNN2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole?
The InChIKey is KGBYMMNGCFTHHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-13-9-4-2-8(3-5-9)10-6-7-11-12-10/h2-7,10-12H,1H3.
What are the key properties of 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole?
3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole has a molecular weight of 176.22 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-2,3-dihydro-1H-pyrazole is sourced from PubChem (CID 154417745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).