C6H13N3S — CID 154418217
5-butan-2-ylsulfanyl-4,5-dihydro-1H-triazole (PubChem CID 154418217) has the molecular formula C6H13N3S and a molecular weight of 159.26 g/mol. Its IUPAC name is 5-butan-2-ylsulfanyl-4,5-dihydro-1H-triazole.
| Compound Name | 5-butan-2-ylsulfanyl-4,5-dihydro-1H-triazole |
|---|---|
| PubChem CID | 154418217 |
| Molecular Formula | C6H13N3S |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 5-butan-2-ylsulfanyl-4,5-dihydro-1H-triazole |
| SMILES | CCC(C)SC1CN=NN1 |
| InChI | InChI=1S/C6H13N3S/c1-3-5(2)10-6-4-7-9-8-6/h5-6H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | XHOBMXZVUBXVFF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |