C19H25N3O3 — CID 154418389
4-[4-(2-morpholin-4-ylpropoxy)phenoxy]benzene-1,2-diamine (PubChem CID 154418389) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[4-(2-morpholin-4-ylpropoxy)phenoxy]benzene-1,2-diamine.
| Compound Name | 4-[4-(2-morpholin-4-ylpropoxy)phenoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 154418389 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-[4-(2-morpholin-4-ylpropoxy)phenoxy]benzene-1,2-diamine |
| SMILES | CC(COc1ccc(Oc2ccc(N)c(N)c2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C19H25N3O3/c1-14(22-8-10-23-11-9-22)13-24-15-2-4-16(5-3-15)25-17-6-7-18(20)19(21)12-17/h2-7,12,14H,8-11,13,20-21H2,1H3 |
| InChIKey | KLZRUJCWHSJIKN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|