C22H22O3 — CID 154418602
3-methylbutyl 2-(2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)acetate (PubChem CID 154418602) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-methylbutyl 2-(2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)acetate.
| Compound Name | 3-methylbutyl 2-(2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)acetate |
|---|---|
| PubChem CID | 154418602 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 3-methylbutyl 2-(2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)acetate |
| SMILES | CC(C)CCOC(=O)Cc1ccc2c(=O)c3ccccc3ccc2c1 |
| InChI | InChI=1S/C22H22O3/c1-15(2)11-12-25-21(23)14-16-7-10-20-18(13-16)9-8-17-5-3-4-6-19(17)22(20)24/h3-10,13,15H,11-12,14H2,1-2H3 |
| InChIKey | IJEANJKYZBNDNA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |