C42H60N2O4 — CID 154419209
3-(3,5-dicyclohexyl-4-hydroxyphenyl)-N'-[3-(3,5-dicyclohexyl-4-hydroxyphenyl)propanoyl]propanehydrazide (PubChem CID 154419209) has the molecular formula C42H60N2O4 and a molecular weight of 656.95 g/mol. Its IUPAC name is 3-(3,5-dicyclohexyl-4-hydroxyphenyl)-N'-[3-(3,5-dicyclohexyl-4-hydroxyphenyl)propanoyl]propanehydrazide.
| Compound Name | 3-(3,5-dicyclohexyl-4-hydroxyphenyl)-N'-[3-(3,5-dicyclohexyl-4-hydroxyphenyl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 154419209 |
| Molecular Formula | C42H60N2O4 |
| Molecular Weight | 656.95 g/mol |
| Exact Mass | 656.46 |
| IUPAC Name | 3-(3,5-dicyclohexyl-4-hydroxyphenyl)-N'-[3-(3,5-dicyclohexyl-4-hydroxyphenyl)propanoyl]propanehydrazide |
| SMILES | O=C(CCc1cc(C2CCCCC2)c(O)c(C2CCCCC2)c1)NNC(=O)CCc1cc(C2CCCCC2)c(O)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C42H60N2O4/c45-39(23-21-29-25-35(31-13-5-1-6-14-31)41(47)36(26-29)32-15-7-2-8-16-32)43-44-40(46)24-22-30-27-37(33-17-9-3-10-18-33)42(48)38(28-30)34-19-11-4-12-20-34/h25-28,31-34,47-48H,1-24H2,(H,43,45)(H,44,46) |
| InChIKey | WXCZSBFKWDAYTQ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.95 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|