C19H29ClSi — CID 154419406
chloro-methyl-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 154419406) has the molecular formula C19H29ClSi and a molecular weight of 320.98 g/mol. Its IUPAC name is chloro-methyl-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | chloro-methyl-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 154419406 |
| Molecular Formula | C19H29ClSi |
| Molecular Weight | 320.98 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | chloro-methyl-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](C)(Cl)C2C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C19H29ClSi/c1-10-11(2)15(6)18(14(10)5)21(9,20)19-16(7)12(3)13(4)17(19)8/h18-19H,1-9H3 |
| InChIKey | SRCDDLWKMFUJMI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.98 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|