C6H8NO2- — CID 154421048
3-prop-2-enyl-1,3-oxazolidin-2-id-4-one (PubChem CID 154421048) has the molecular formula C6H8NO2- and a molecular weight of 126.13 g/mol. Its IUPAC name is 3-prop-2-enyl-1,3-oxazolidin-2-id-4-one.
| Compound Name | 3-prop-2-enyl-1,3-oxazolidin-2-id-4-one |
|---|---|
| PubChem CID | 154421048 |
| Molecular Formula | C6H8NO2- |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | 3-prop-2-enyl-1,3-oxazolidin-2-id-4-one |
| SMILES | C=CCN1[CH-]OCC1=O |
| InChI | InChI=1S/C6H8NO2/c1-2-3-7-5-9-4-6(7)8/h2,5H,1,3-4H2/q-1 |
| InChIKey | RTGGVZUVYDVACX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|