About dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene
dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene (PubChem CID 154423024) has the molecular formula C8H11Cl2Zr-
and a molecular weight of 269.31 g/mol. Its IUPAC name is dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene |
| PubChem CID | 154423024 |
| Molecular Formula | C8H11Cl2Zr- |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 266.93 |
| IUPAC Name | dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene |
| SMILES | Cc1cc[c-](C)c1C.Cl[Zr]Cl |
| InChI | InChI=1S/C8H11.2ClH.Zr/c1-6-4-5-7(2)8(6)3;;;/h4-5H,1-3H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | NIPZPKUQHJUBIF-UHFFFAOYSA-L |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene?
The IUPAC name of dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene (CID 154423024) is dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene.
What is the SMILES notation for dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene?
The canonical SMILES for dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene is Cc1cc[c-](C)c1C.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene?
The InChIKey is NIPZPKUQHJUBIF-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H11.2ClH.Zr/c1-6-4-5-7(2)8(6)3;;;/h4-5H,1-3H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene?
dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene has a molecular weight of 269.31 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;1,2,5-trimethylcyclopenta-1,3-diene is sourced from PubChem (CID 154423024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).