About 6-(trifluoromethyl)-1,4-benzoxazin-2-one
6-(trifluoromethyl)-1,4-benzoxazin-2-one (PubChem CID 154423234) has the molecular formula C9H4F3NO2
and a molecular weight of 215.13 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1,4-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-1,4-benzoxazin-2-one |
| PubChem CID | 154423234 |
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 6-(trifluoromethyl)-1,4-benzoxazin-2-one |
| SMILES | O=c1cnc2cc(C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C9H4F3NO2/c10-9(11,12)5-1-2-7-6(3-5)13-4-8(14)15-7/h1-4H |
| InChIKey | PCZNVXHKVWXEMI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(trifluoromethyl)-1,4-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-1,4-benzoxazin-2-one?
The IUPAC name of 6-(trifluoromethyl)-1,4-benzoxazin-2-one (CID 154423234) is 6-(trifluoromethyl)-1,4-benzoxazin-2-one.
What is the SMILES notation for 6-(trifluoromethyl)-1,4-benzoxazin-2-one?
The canonical SMILES for 6-(trifluoromethyl)-1,4-benzoxazin-2-one is O=c1cnc2cc(C(F)(F)F)ccc2o1.
What is the InChIKey of 6-(trifluoromethyl)-1,4-benzoxazin-2-one?
The InChIKey is PCZNVXHKVWXEMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3NO2/c10-9(11,12)5-1-2-7-6(3-5)13-4-8(14)15-7/h1-4H.
What are the key properties of 6-(trifluoromethyl)-1,4-benzoxazin-2-one?
6-(trifluoromethyl)-1,4-benzoxazin-2-one has a molecular weight of 215.13 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-1,4-benzoxazin-2-one is sourced from PubChem (CID 154423234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).