C13H22O3 — CID 15442350
8a-(2-methoxyethoxy)-1,2,3,3a,5,6,7,8-octahydroazulen-4-one (PubChem CID 15442350) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 8a-(2-methoxyethoxy)-1,2,3,3a,5,6,7,8-octahydroazulen-4-one.
| Compound Name | 8a-(2-methoxyethoxy)-1,2,3,3a,5,6,7,8-octahydroazulen-4-one |
|---|---|
| PubChem CID | 15442350 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 8a-(2-methoxyethoxy)-1,2,3,3a,5,6,7,8-octahydroazulen-4-one |
| SMILES | COCCOC12CCCCC(=O)C1CCC2 |
| InChI | InChI=1S/C13H22O3/c1-15-9-10-16-13-7-3-2-6-12(14)11(13)5-4-8-13/h11H,2-10H2,1H3 |
| InChIKey | DUHXNSMJIYGCFP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|