C20H18N4O5S2 — CID 154425395
(6R)-3-(anilinocarbamoyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154425395) has the molecular formula C20H18N4O5S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is (6R)-3-(anilinocarbamoyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-(anilinocarbamoyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154425395 |
| Molecular Formula | C20H18N4O5S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | (6R)-3-(anilinocarbamoyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(Cc1cccs1)NC1C(=O)N2C(C(=O)O)=C(C(=O)NNc3ccccc3)CS[C@H]12 |
| InChI | InChI=1S/C20H18N4O5S2/c25-14(9-12-7-4-8-30-12)21-15-18(27)24-16(20(28)29)13(10-31-19(15)24)17(26)23-22-11-5-2-1-3-6-11/h1-8,15,19,22H,9-10H2,(H,21,25)(H,23,26)(H,28,29)/t15?,19-/m1/s1 |
| InChIKey | GLWYGKAXRARGJX-XCWJXAQQSA-N |
| XLogP | 1.17 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|