About 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one
5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one (PubChem CID 154425793) has the molecular formula C5H3F6N3O
and a molecular weight of 235.09 g/mol. Its IUPAC name is 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one |
| PubChem CID | 154425793 |
| Molecular Formula | C5H3F6N3O |
| Molecular Weight | 235.09 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)NC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F6N3O/c6-4(7,8)3(5(9,10)11)1(12)13-2(15)14-3/h(H3,12,13,14,15) |
| InChIKey | KUYUQJBJKGIQFE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.09 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one?
The IUPAC name of 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one (CID 154425793) is 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one.
What is the SMILES notation for 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one?
The canonical SMILES for 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one is [H]/N=C1\NC(=O)NC1(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one?
The InChIKey is KUYUQJBJKGIQFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F6N3O/c6-4(7,8)3(5(9,10)11)1(12)13-2(15)14-3/h(H3,12,13,14,15).
What are the key properties of 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one?
5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one has a molecular weight of 235.09 g/mol, XLogP of 1.14, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-4,4-bis(trifluoromethyl)imidazolidin-2-one is sourced from PubChem (CID 154425793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).