About bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium
bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium (PubChem CID 154427103) has the molecular formula C16H26ScSi2-2
and a molecular weight of 319.51 g/mol. Its IUPAC name is bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium.
Molecular Properties
| Compound Name | bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium |
| PubChem CID | 154427103 |
| Molecular Formula | C16H26ScSi2-2 |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium |
| SMILES | C[Si](C)(C)[c-]1cccc1.C[Si](C)(C)[c-]1cccc1.[Sc] |
| InChI | InChI=1S/2C8H13Si.Sc/c2*1-9(2,3)8-6-4-5-7-8;/h2*4-7H,1-3H3;/q2*-1; |
| InChIKey | IUXNRGQZSXAIFX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium?
The IUPAC name of bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium (CID 154427103) is bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium.
What is the SMILES notation for bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium?
The canonical SMILES for bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium is C[Si](C)(C)[c-]1cccc1.C[Si](C)(C)[c-]1cccc1.[Sc].
What is the InChIKey of bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium?
The InChIKey is IUXNRGQZSXAIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H13Si.Sc/c2*1-9(2,3)8-6-4-5-7-8;/h2*4-7H,1-3H3;/q2*-1;.
What are the key properties of bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium?
bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium has a molecular weight of 319.51 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopenta-2,4-dien-1-yl(trimethyl)silane);scandium is sourced from PubChem (CID 154427103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).