About chlorochromium(2+);bis(cyclopenta-1,3-diene)
chlorochromium(2+);bis(cyclopenta-1,3-diene) (PubChem CID 154427565) has the molecular formula C10H10ClCr
and a molecular weight of 217.64 g/mol. Its IUPAC name is chlorochromium(2+);bis(cyclopenta-1,3-diene).
Molecular Properties
| Compound Name | chlorochromium(2+);bis(cyclopenta-1,3-diene) |
| PubChem CID | 154427565 |
| Molecular Formula | C10H10ClCr |
| Molecular Weight | 217.64 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | chlorochromium(2+);bis(cyclopenta-1,3-diene) |
| SMILES | Cl[Cr+2].c1cc[cH-]c1.c1cc[cH-]c1 |
| InChI | InChI=1S/2C5H5.ClH.Cr/c2*1-2-4-5-3-1;;/h2*1-5H;1H;/q2*-1;;+3/p-1 |
| InChIKey | RASWPXPYDSRMMQ-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chlorochromium(2+);bis(cyclopenta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorochromium(2+);bis(cyclopenta-1,3-diene)?
The IUPAC name of chlorochromium(2+);bis(cyclopenta-1,3-diene) (CID 154427565) is chlorochromium(2+);bis(cyclopenta-1,3-diene).
What is the SMILES notation for chlorochromium(2+);bis(cyclopenta-1,3-diene)?
The canonical SMILES for chlorochromium(2+);bis(cyclopenta-1,3-diene) is Cl[Cr+2].c1cc[cH-]c1.c1cc[cH-]c1.
What is the InChIKey of chlorochromium(2+);bis(cyclopenta-1,3-diene)?
The InChIKey is RASWPXPYDSRMMQ-UHFFFAOYSA-M. The full InChI is InChI=1S/2C5H5.ClH.Cr/c2*1-2-4-5-3-1;;/h2*1-5H;1H;/q2*-1;;+3/p-1.
What are the key properties of chlorochromium(2+);bis(cyclopenta-1,3-diene)?
chlorochromium(2+);bis(cyclopenta-1,3-diene) has a molecular weight of 217.64 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorochromium(2+);bis(cyclopenta-1,3-diene) is sourced from PubChem (CID 154427565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).