C25H24ClNO3 — CID 15442913
2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol (PubChem CID 15442913) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is 2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol.
| Compound Name | 2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol |
|---|---|
| PubChem CID | 15442913 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol |
| SMILES | COC[C@@H]1N=C(C(Cl)C(O)(c2ccccc2)c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H24ClNO3/c1-29-17-21-22(18-11-5-2-6-12-18)30-24(27-21)23(26)25(28,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21-23,28H,17H2,1H3/t21-,22-,23?/m0/s1 |
| InChIKey | ANNDULQUZUWKSI-OJSMNCEXSA-N |
| XLogP | 4.71 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|