About [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid
[[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid (PubChem CID 154429591) has the molecular formula C16H25BrClO4P
and a molecular weight of 427.70 g/mol. Its IUPAC name is [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid.
Molecular Properties
| Compound Name | [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid |
| PubChem CID | 154429591 |
| Molecular Formula | C16H25BrClO4P |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid |
| SMILES | CC(C)(C)c1cc(C(O)P(=O)(O)O)c(Cl)c(C(C)(C)C)c1CBr |
| InChI | InChI=1S/C16H25BrClO4P/c1-15(2,3)11-7-9(14(19)23(20,21)22)13(18)12(10(11)8-17)16(4,5)6/h7,14,19H,8H2,1-6H3,(H2,20,21,22) |
| InChIKey | DDCGVDGFAPUVLG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid?
The IUPAC name of [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid (CID 154429591) is [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid.
What is the SMILES notation for [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid?
The canonical SMILES for [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid is CC(C)(C)c1cc(C(O)P(=O)(O)O)c(Cl)c(C(C)(C)C)c1CBr.
What is the InChIKey of [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid?
The InChIKey is DDCGVDGFAPUVLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25BrClO4P/c1-15(2,3)11-7-9(14(19)23(20,21)22)13(18)12(10(11)8-17)16(4,5)6/h7,14,19H,8H2,1-6H3,(H2,20,21,22).
What are the key properties of [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid?
[[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid has a molecular weight of 427.70 g/mol, XLogP of 5.00, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(bromomethyl)-3,5-ditert-butyl-2-chlorophenyl]-hydroxymethyl]phosphonic acid is sourced from PubChem (CID 154429591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).